About [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate
[3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate (PubChem CID 176718112) has the molecular formula C15H14F2N3O3-
and a molecular weight of 322.29 g/mol. Its IUPAC name is [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate.
Molecular Properties
| Compound Name | [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate |
| PubChem CID | 176718112 |
| Molecular Formula | C15H14F2N3O3- |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate |
| SMILES | O=C(OC1CC(n2nccc2C(F)F)C1)c1ccc(N[O-])cc1 |
| InChI | InChI=1S/C15H14F2N3O3/c16-14(17)13-5-6-18-20(13)11-7-12(8-11)23-15(21)9-1-3-10(19-22)4-2-9/h1-6,11-12,14,19H,7-8H2/q-1 |
| InChIKey | FRIQHDNTBVMTIP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate?
The IUPAC name of [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate (CID 176718112) is [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate.
What is the SMILES notation for [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate?
The canonical SMILES for [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate is O=C(OC1CC(n2nccc2C(F)F)C1)c1ccc(N[O-])cc1.
What is the InChIKey of [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate?
The InChIKey is FRIQHDNTBVMTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N3O3/c16-14(17)13-5-6-18-20(13)11-7-12(8-11)23-15(21)9-1-3-10(19-22)4-2-9/h1-6,11-12,14,19H,7-8H2/q-1.
What are the key properties of [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate?
[3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate has a molecular weight of 322.29 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(difluoromethyl)pyrazol-1-yl]cyclobutyl] 4-(oxidoamino)benzoate is sourced from PubChem (CID 176718112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).