About tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate
tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate (PubChem CID 176719503) has the molecular formula C19H29N3O6S
and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate |
| PubChem CID | 176719503 |
| Molecular Formula | C19H29N3O6S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C2CCCNCC2NC(=O)OC(C)(C)C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C19H29N3O6S/c1-12-8-9-16(17(13(12)2)22(24)25)29(26,27)15-7-6-10-20-11-14(15)21-18(23)28-19(3,4)5/h8-9,14-15,20H,6-7,10-11H2,1-5H3,(H,21,23) |
| InChIKey | NJWHNHKFGKFYQT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate?
The IUPAC name of tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate (CID 176719503) is tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate is Cc1ccc(S(=O)(=O)C2CCCNCC2NC(=O)OC(C)(C)C)c([N+](=O)[O-])c1C.
What is the InChIKey of tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate?
The InChIKey is NJWHNHKFGKFYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O6S/c1-12-8-9-16(17(13(12)2)22(24)25)29(26,27)15-7-6-10-20-11-14(15)21-18(23)28-19(3,4)5/h8-9,14-15,20H,6-7,10-11H2,1-5H3,(H,21,23).
What are the key properties of tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate?
tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate has a molecular weight of 427.52 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(3,4-dimethyl-2-nitrophenyl)sulfonylazepan-3-yl]carbamate is sourced from PubChem (CID 176719503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).