C13H11F6N3O5S — CID 176720302
[7-methyl-5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-3-oxa-4,9,10-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-11-yl] trifluoromethanesulfonate (PubChem CID 176720302) has the molecular formula C13H11F6N3O5S and a molecular weight of 435.30 g/mol. Its IUPAC name is [7-methyl-5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-3-oxa-4,9,10-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-11-yl] trifluoromethanesulfonate.
| Compound Name | [7-methyl-5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-3-oxa-4,9,10-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176720302 |
| Molecular Formula | C13H11F6N3O5S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | [7-methyl-5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-3-oxa-4,9,10-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-11-yl] trifluoromethanesulfonate |
| SMILES | CC1Cn2nc(OS(=O)(=O)C(F)(F)F)cc2-c2onc([C@@](C)(O)C(F)(F)F)c21 |
| InChI | InChI=1S/C13H11F6N3O5S/c1-5-4-22-6(3-7(20-22)27-28(24,25)13(17,18)19)9-8(5)10(21-26-9)11(2,23)12(14,15)16/h3,5,23H,4H2,1-2H3/t5?,11-/m1/s1 |
| InChIKey | WABMLLWNQBDQFW-JDLXGLENSA-N |
| XLogP | 2.65 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|