C21H16F4I2O6 — CID 176720460
2-[[2-(2,2-dimethylbutanoyloxy)-3,5-diiodophenyl]methoxycarbonyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 176720460) has the molecular formula C21H16F4I2O6 and a molecular weight of 694.15 g/mol. Its IUPAC name is 2-[[2-(2,2-dimethylbutanoyloxy)-3,5-diiodophenyl]methoxycarbonyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[[2-(2,2-dimethylbutanoyloxy)-3,5-diiodophenyl]methoxycarbonyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 176720460 |
| Molecular Formula | C21H16F4I2O6 |
| Molecular Weight | 694.15 g/mol |
| Exact Mass | 693.90 |
| IUPAC Name | 2-[[2-(2,2-dimethylbutanoyloxy)-3,5-diiodophenyl]methoxycarbonyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | CCC(C)(C)C(=O)Oc1c(I)cc(I)cc1COC(=O)c1c(F)c(F)c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C21H16F4I2O6/c1-4-21(2,3)20(31)33-17-8(5-9(26)6-10(17)27)7-32-19(30)12-11(18(28)29)13(22)15(24)16(25)14(12)23/h5-6H,4,7H2,1-3H3,(H,28,29) |
| InChIKey | BQHUBEBVKKPWOO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.15 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|