About 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate
2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate (PubChem CID 176720466) has the molecular formula C19H13I2O7-
and a molecular weight of 607.11 g/mol. Its IUPAC name is 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate.
Molecular Properties
| Compound Name | 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate |
| PubChem CID | 176720466 |
| Molecular Formula | C19H13I2O7- |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.88 |
| IUPAC Name | 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate |
| SMILES | C=C(C)C(=O)Oc1c(I)cc(COC(=O)c2cccc(C(=O)O)c2[O-])cc1I |
| InChI | InChI=1S/C19H14I2O7/c1-9(2)18(25)28-16-13(20)6-10(7-14(16)21)8-27-19(26)12-5-3-4-11(15(12)22)17(23)24/h3-7,22H,1,8H2,2H3,(H,23,24)/p-1 |
| InChIKey | ZMKBWQZNLNJCTF-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate?
The IUPAC name of 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate (CID 176720466) is 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate.
What is the SMILES notation for 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate?
The canonical SMILES for 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate is C=C(C)C(=O)Oc1c(I)cc(COC(=O)c2cccc(C(=O)O)c2[O-])cc1I.
What is the InChIKey of 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate?
The InChIKey is ZMKBWQZNLNJCTF-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H14I2O7/c1-9(2)18(25)28-16-13(20)6-10(7-14(16)21)8-27-19(26)12-5-3-4-11(15(12)22)17(23)24/h3-7,22H,1,8H2,2H3,(H,23,24)/p-1.
What are the key properties of 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate?
2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate has a molecular weight of 607.11 g/mol, XLogP of 3.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxy-6-[[3,5-diiodo-4-(2-methylprop-2-enoyloxy)phenyl]methoxycarbonyl]phenolate is sourced from PubChem (CID 176720466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).