2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid

C21H22N2O4 — CID 176721280

IUPAC2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid
SMILESC[C@@H]1[C@@H](CC(=O)O)N(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1
InChIInChI=1S/C21H22N2O4/c1-15-18(14-19(24)25)23(21(27)17-10-6-3-7-11-17)13-12-22(15)20(26)16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3,(H,24,25)/t15-,18-/m1/s1
InChIKeyFSEYYNLBYFVSIV-CRAIPNDOSA-N
MW366.42 g/mol
LogP2.52
Rot. Bonds4

About 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid

2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid (PubChem CID 176721280) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid
PubChem CID176721280
Molecular FormulaC21H22N2O4
Molecular Weight366.42 g/mol
Exact Mass366.16
IUPAC Name2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid
SMILESC[C@@H]1[C@@H](CC(=O)O)N(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1
InChIInChI=1S/C21H22N2O4/c1-15-18(14-19(24)25)23(21(27)17-10-6-3-7-11-17)13-12-22(15)20(26)16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3,(H,24,25)/t15-,18-/m1/s1
InChIKeyFSEYYNLBYFVSIV-CRAIPNDOSA-N
XLogP2.52
TPSA77.92 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.42
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid?
The IUPAC name of 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid (CID 176721280) is 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid.
What is the SMILES notation for 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid?
The canonical SMILES for 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid is C[C@@H]1[C@@H](CC(=O)O)N(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1.
What is the InChIKey of 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid?
The InChIKey is FSEYYNLBYFVSIV-CRAIPNDOSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-15-18(14-19(24)25)23(21(27)17-10-6-3-7-11-17)13-12-22(15)20(26)16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3,(H,24,25)/t15-,18-/m1/s1.
What are the key properties of 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid?
2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid has a molecular weight of 366.42 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-1,4-dibenzoyl-3-methylpiperazin-2-yl]acetic acid is sourced from PubChem (CID 176721280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).