C22H25N3O2 — CID 176722679
2-[4-[5-ethynyl-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperazin-1-yl]-1-phenylethanone (PubChem CID 176722679) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[4-[5-ethynyl-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperazin-1-yl]-1-phenylethanone.
| Compound Name | 2-[4-[5-ethynyl-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperazin-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 176722679 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-[4-[5-ethynyl-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperazin-1-yl]-1-phenylethanone |
| SMILES | C#Cc1cc(N2CCN(CC(=O)c3ccccc3)CC2)cnc1[C@H](C)OC |
| InChI | InChI=1S/C22H25N3O2/c1-4-18-14-20(15-23-22(18)17(2)27-3)25-12-10-24(11-13-25)16-21(26)19-8-6-5-7-9-19/h1,5-9,14-15,17H,10-13,16H2,2-3H3/t17-/m0/s1 |
| InChIKey | QOKHTJKHCZLGCZ-KRWDZBQOSA-N |
| XLogP | 2.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|