C62H52N3OPt- — CID 176722944
2-[1-(3-ethyl-4-phenylphenyl)-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]-4,6-di(propan-2-yl)phenol;platinum (PubChem CID 176722944) has the molecular formula C62H52N3OPt- and a molecular weight of 1050.20 g/mol. Its IUPAC name is 2-[1-(3-ethyl-4-phenylphenyl)-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]-4,6-di(propan-2-yl)phenol;platinum.
| Compound Name | 2-[1-(3-ethyl-4-phenylphenyl)-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]-4,6-di(propan-2-yl)phenol;platinum |
|---|---|
| PubChem CID | 176722944 |
| Molecular Formula | C62H52N3OPt- |
| Molecular Weight | 1050.20 g/mol |
| Exact Mass | 1049.38 |
| IUPAC Name | 2-[1-(3-ethyl-4-phenylphenyl)-4-[3-phenyl-5-[4-(4-phenylphenyl)-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]-4,6-di(propan-2-yl)phenol;platinum |
| SMILES | CCc1cc(-n2c(-c3cc(C(C)C)cc(C(C)C)c3O)nc3c(-c4[c-]c(-c5cc(-c6ccc(-c7ccccc7)cc6)ccn5)cc(-c5ccccc5)c4)cccc32)ccc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C62H52N3O.Pt/c1-6-42-36-53(29-30-54(42)47-21-14-9-15-22-47)65-59-24-16-23-55(60(59)64-62(65)57-38-49(40(2)3)37-56(41(4)5)61(57)66)51-33-50(44-19-12-8-13-20-44)34-52(35-51)58-39-48(31-32-63-58)46-27-25-45(26-28-46)43-17-10-7-11-18-43;/h7-34,36-41,66H,6H2,1-5H3;/q-1; |
| InChIKey | OQJDVJNPJHCSPF-UHFFFAOYSA-N |
| XLogP | 16.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.20 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|