C9H6F3N3O2 — CID 176724107
5-nitro-6-(2,2,2-trifluoroethyl)-1H-indazole (PubChem CID 176724107) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 5-nitro-6-(2,2,2-trifluoroethyl)-1H-indazole.
| Compound Name | 5-nitro-6-(2,2,2-trifluoroethyl)-1H-indazole |
|---|---|
| PubChem CID | 176724107 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-nitro-6-(2,2,2-trifluoroethyl)-1H-indazole |
| SMILES | O=[N+]([O-])c1cc2cn[nH]c2cc1CC(F)(F)F |
| InChI | InChI=1S/C9H6F3N3O2/c10-9(11,12)3-5-1-7-6(4-13-14-7)2-8(5)15(16)17/h1-2,4H,3H2,(H,13,14) |
| InChIKey | UJTVRROSGGGGMM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|