C24H12Br2N2O3 — CID 176724226
14-(2,6-dibromo-4-nitrophenyl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 176724226) has the molecular formula C24H12Br2N2O3 and a molecular weight of 536.18 g/mol. Its IUPAC name is 14-(2,6-dibromo-4-nitrophenyl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 14-(2,6-dibromo-4-nitrophenyl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 176724226 |
| Molecular Formula | C24H12Br2N2O3 |
| Molecular Weight | 536.18 g/mol |
| Exact Mass | 533.92 |
| IUPAC Name | 14-(2,6-dibromo-4-nitrophenyl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | O=[N+]([O-])c1cc(Br)c(-n2c3ccccc3c3c4c(ccc32)oc2ccccc24)c(Br)c1 |
| InChI | InChI=1S/C24H12Br2N2O3/c25-16-11-13(28(29)30)12-17(26)24(16)27-18-7-3-1-5-14(18)22-19(27)9-10-21-23(22)15-6-2-4-8-20(15)31-21/h1-12H |
| InChIKey | KBHNGLGNJVNKIN-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 61.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.18 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|