C70H65GeNS — CID 176724280
[4-([1]benzothiolo[2,3-b]carbazol-7-yl)-3,5-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-triphenylgermane (PubChem CID 176724280) has the molecular formula C70H65GeNS and a molecular weight of 1024.97 g/mol. Its IUPAC name is [4-([1]benzothiolo[2,3-b]carbazol-7-yl)-3,5-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-triphenylgermane.
| Compound Name | [4-([1]benzothiolo[2,3-b]carbazol-7-yl)-3,5-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-triphenylgermane |
|---|---|
| PubChem CID | 176724280 |
| Molecular Formula | C70H65GeNS |
| Molecular Weight | 1024.97 g/mol |
| Exact Mass | 1025.40 |
| IUPAC Name | [4-([1]benzothiolo[2,3-b]carbazol-7-yl)-3,5-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-triphenylgermane |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc([Ge](c4ccccc4)(c4ccccc4)c4ccccc4)cc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)c3-n3c4ccccc4c4cc5c(cc43)sc3ccccc35)ccc21 |
| InChI | InChI=1S/C70H65GeNS/c1-67(2)36-38-69(5,6)60-40-46(32-34-58(60)67)54-42-51(71(48-22-12-9-13-23-48,49-24-14-10-15-25-49)50-26-16-11-17-27-50)43-55(47-33-35-59-61(41-47)70(7,8)39-37-68(59,3)4)66(54)72-62-30-20-18-28-52(62)56-44-57-53-29-19-21-31-64(53)73-65(57)45-63(56)72/h9-35,40-45H,36-39H2,1-8H3 |
| InChIKey | RSVFKWMFKZYRQN-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.97 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |