About [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium
[3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium (PubChem CID 176725833) has the molecular formula C26H21S+
and a molecular weight of 365.52 g/mol. Its IUPAC name is [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium.
Molecular Properties
| Compound Name | [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium |
| PubChem CID | 176725833 |
| Molecular Formula | C26H21S+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium |
| SMILES | C=C/C=C\c1cccc([S+](c2ccccc2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H21S/c1-2-3-11-21-12-9-17-24(20-21)27(23-15-5-4-6-16-23)26-19-10-14-22-13-7-8-18-25(22)26/h2-20H,1H2/q+1/b11-3- |
| InChIKey | JNLUSSLVMVUXPH-JYOAFUTRSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium?
The IUPAC name of [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium (CID 176725833) is [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium.
What is the SMILES notation for [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium?
The canonical SMILES for [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium is C=C/C=C\c1cccc([S+](c2ccccc2)c2cccc3ccccc23)c1.
What is the InChIKey of [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium?
The InChIKey is JNLUSSLVMVUXPH-JYOAFUTRSA-N. The full InChI is InChI=1S/C26H21S/c1-2-3-11-21-12-9-17-24(20-21)27(23-15-5-4-6-16-23)26-19-10-14-22-13-7-8-18-25(22)26/h2-20H,1H2/q+1/b11-3-.
What are the key properties of [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium?
[3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium has a molecular weight of 365.52 g/mol, XLogP of 7.13, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1Z)-buta-1,3-dienyl]phenyl]-naphthalen-1-yl-phenylsulfanium is sourced from PubChem (CID 176725833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).