C23H15BrFN3O3S — CID 176725951
5-bromo-3-(2-fluoro-4-pyridinyl)-2-(furan-3-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 176725951) has the molecular formula C23H15BrFN3O3S and a molecular weight of 512.36 g/mol. Its IUPAC name is 5-bromo-3-(2-fluoro-4-pyridinyl)-2-(furan-3-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-3-(2-fluoro-4-pyridinyl)-2-(furan-3-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176725951 |
| Molecular Formula | C23H15BrFN3O3S |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | 5-bromo-3-(2-fluoro-4-pyridinyl)-2-(furan-3-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccoc3)c(-c3ccnc(F)c3)c3cc(Br)cnc32)cc1 |
| InChI | InChI=1S/C23H15BrFN3O3S/c1-14-2-4-18(5-3-14)32(29,30)28-22(16-7-9-31-13-16)21(15-6-8-26-20(25)10-15)19-11-17(24)12-27-23(19)28/h2-13H,1H3 |
| InChIKey | PEFSSHQTTRCEQL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|