C17H30N2O4 — CID 176727093
(5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(4,6-dihydroxy-2-methoxy-3-methylcyclohexyl)methanone (PubChem CID 176727093) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(4,6-dihydroxy-2-methoxy-3-methylcyclohexyl)methanone.
| Compound Name | (5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(4,6-dihydroxy-2-methoxy-3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 176727093 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(4,6-dihydroxy-2-methoxy-3-methylcyclohexyl)methanone |
| SMILES | COC1C(C)C(O)CC(O)C1C(=O)N1CC2CCC(N)CC2C1 |
| InChI | InChI=1S/C17H30N2O4/c1-9-13(20)6-14(21)15(16(9)23-2)17(22)19-7-10-3-4-12(18)5-11(10)8-19/h9-16,20-21H,3-8,18H2,1-2H3 |
| InChIKey | DTJCYGRJHNHVKC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |