About 4,4-difluorodiazepane
4,4-difluorodiazepane (PubChem CID 176727896) has the molecular formula C5H10F2N2
and a molecular weight of 136.14 g/mol. Its IUPAC name is 4,4-difluorodiazepane.
Molecular Properties
| Compound Name | 4,4-difluorodiazepane |
| PubChem CID | 176727896 |
| Molecular Formula | C5H10F2N2 |
| Molecular Weight | 136.14 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | 4,4-difluorodiazepane |
| SMILES | FC1(F)CCCNNC1 |
| InChI | InChI=1S/C5H10F2N2/c6-5(7)2-1-3-8-9-4-5/h8-9H,1-4H2 |
| InChIKey | ZVNWBGVHUKAIGI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluorodiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorodiazepane?
The IUPAC name of 4,4-difluorodiazepane (CID 176727896) is 4,4-difluorodiazepane.
What is the SMILES notation for 4,4-difluorodiazepane?
The canonical SMILES for 4,4-difluorodiazepane is FC1(F)CCCNNC1.
What is the InChIKey of 4,4-difluorodiazepane?
The InChIKey is ZVNWBGVHUKAIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2/c6-5(7)2-1-3-8-9-4-5/h8-9H,1-4H2.
What are the key properties of 4,4-difluorodiazepane?
4,4-difluorodiazepane has a molecular weight of 136.14 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorodiazepane is sourced from PubChem (CID 176727896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).