C14H27N — CID 176728440
(1S,4S)-2,5-ditert-butyl-1,3,3,4,6,6,7,7-octadeuterio-2-azabicyclo[2.2.1]heptane (PubChem CID 176728440) has the molecular formula C14H27N and a molecular weight of 217.43 g/mol. Its IUPAC name is (1S,4S)-2,5-ditert-butyl-1,3,3,4,6,6,7,7-octadeuterio-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2,5-ditert-butyl-1,3,3,4,6,6,7,7-octadeuterio-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176728440 |
| Molecular Formula | C14H27N |
| Molecular Weight | 217.43 g/mol |
| Exact Mass | 217.26 |
| IUPAC Name | (1S,4S)-2,5-ditert-butyl-1,3,3,4,6,6,7,7-octadeuterio-2-azabicyclo[2.2.1]heptane |
| SMILES | [2H]C1([2H])N(C(C)(C)C)[C@@]2([2H])C([2H])([2H])C(C(C)(C)C)[C@]1([2H])C2([2H])[2H] |
| InChI | InChI=1S/C14H27N/c1-13(2,3)12-8-11-7-10(12)9-15(11)14(4,5)6/h10-12H,7-9H2,1-6H3/t10-,11-,12?/m1/s1/i7D2,8D2,9D2,10D,11D |
| InChIKey | VKYYFFNFJXABRD-MXIWGMBTSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |