C9H18N2 — CID 176728634
2-tert-butyl-1,3,3,4,6,7,7-heptadeuterio-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 176728634) has the molecular formula C9H18N2 and a molecular weight of 161.30 g/mol. Its IUPAC name is 2-tert-butyl-1,3,3,4,6,7,7-heptadeuterio-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | 2-tert-butyl-1,3,3,4,6,7,7-heptadeuterio-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176728634 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 161.30 g/mol |
| Exact Mass | 161.19 |
| IUPAC Name | 2-tert-butyl-1,3,3,4,6,7,7-heptadeuterio-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | [2H]C1NC2([2H])C([2H])([2H])N(C(C)(C)C)C1([2H])C2([2H])[2H] |
| InChI | InChI=1S/C9H18N2/c1-9(2,3)11-6-7-4-8(11)5-10-7/h7-8,10H,4-6H2,1-3H3/i4D2,5D,6D2,7D,8D |
| InChIKey | FDVWVWGMABVHAS-UHBWWAFZSA-N |
| XLogP | 0.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |