About 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one
6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one (PubChem CID 176729189) has the molecular formula C15H19Cl2N3O
and a molecular weight of 328.24 g/mol. Its IUPAC name is 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one.
Molecular Properties
| Compound Name | 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one |
| PubChem CID | 176729189 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one |
| SMILES | CC1NC(Cc2c(Cl)cc(N)cc2Cl)=CN(C(C)C)C1=O |
| InChI | InChI=1S/C15H19Cl2N3O/c1-8(2)20-7-11(19-9(3)15(20)21)6-12-13(16)4-10(18)5-14(12)17/h4-5,7-9,19H,6,18H2,1-3H3 |
| InChIKey | SWAAOLZAVNNWPW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one?
The IUPAC name of 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one (CID 176729189) is 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one.
What is the SMILES notation for 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one?
The canonical SMILES for 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one is CC1NC(Cc2c(Cl)cc(N)cc2Cl)=CN(C(C)C)C1=O.
What is the InChIKey of 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one?
The InChIKey is SWAAOLZAVNNWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N3O/c1-8(2)20-7-11(19-9(3)15(20)21)6-12-13(16)4-10(18)5-14(12)17/h4-5,7-9,19H,6,18H2,1-3H3.
What are the key properties of 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one?
6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one has a molecular weight of 328.24 g/mol, XLogP of 3.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-amino-2,6-dichlorophenyl)methyl]-2-methyl-4-propan-2-yl-1,2-dihydropyrazin-3-one is sourced from PubChem (CID 176729189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).