C21H21N5O3 — CID 176729756
N-(4-methylphenyl)-2-[2-[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]hydrazinyl]acetamide (PubChem CID 176729756) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[2-[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]hydrazinyl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[2-[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]hydrazinyl]acetamide |
|---|---|
| PubChem CID | 176729756 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(4-methylphenyl)-2-[2-[2-(6-oxo-3-phenylpyridazin-1-yl)acetyl]hydrazinyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CNNC(=O)Cn2nc(-c3ccccc3)ccc2=O)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-15-7-9-17(10-8-15)23-19(27)13-22-24-20(28)14-26-21(29)12-11-18(25-26)16-5-3-2-4-6-16/h2-12,22H,13-14H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | ZXBREIWOIAUYDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|