C26H32N2O2 — CID 176729921
2-[(2R,3R,4aS,8aS)-3-(2-hydroxy-3-prop-2-enylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-prop-2-enylphenol (PubChem CID 176729921) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[(2R,3R,4aS,8aS)-3-(2-hydroxy-3-prop-2-enylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-prop-2-enylphenol.
| Compound Name | 2-[(2R,3R,4aS,8aS)-3-(2-hydroxy-3-prop-2-enylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 176729921 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2-[(2R,3R,4aS,8aS)-3-(2-hydroxy-3-prop-2-enylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cccc([C@H]2N[C@H]3CCCC[C@@H]3N[C@@H]2c2cccc(CC=C)c2O)c1O |
| InChI | InChI=1S/C26H32N2O2/c1-3-9-17-11-7-13-19(25(17)29)23-24(28-22-16-6-5-15-21(22)27-23)20-14-8-12-18(10-4-2)26(20)30/h3-4,7-8,11-14,21-24,27-30H,1-2,5-6,9-10,15-16H2/t21-,22-,23+,24+/m0/s1 |
| InChIKey | DXEUSVZQBCNGHU-CJRSTVEYSA-N |
| XLogP | 4.84 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|