C22H22F6N2O2 — CID 176729925
2-[(2S,3S,4aR,8aR)-3-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-5-(trifluoromethyl)phenol (PubChem CID 176729925) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is 2-[(2S,3S,4aR,8aR)-3-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[(2S,3S,4aR,8aR)-3-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 176729925 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[(2S,3S,4aR,8aR)-3-[2-hydroxy-4-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-5-(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)ccc1[C@@H]1N[C@@H]2CCCC[C@H]2N[C@H]1c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C22H22F6N2O2/c23-21(24,25)11-5-7-13(17(31)9-11)19-20(30-16-4-2-1-3-15(16)29-19)14-8-6-12(10-18(14)32)22(26,27)28/h5-10,15-16,19-20,29-32H,1-4H2/t15-,16-,19+,20+/m1/s1 |
| InChIKey | ZBNUCRIEUQRTQR-YKCBXCCJSA-N |
| XLogP | 5.42 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|