C13H6F3NO3 — CID 176730094
2-nitro-4-(3,4,5-trifluorophenyl)benzaldehyde (PubChem CID 176730094) has the molecular formula C13H6F3NO3 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-nitro-4-(3,4,5-trifluorophenyl)benzaldehyde.
| Compound Name | 2-nitro-4-(3,4,5-trifluorophenyl)benzaldehyde |
|---|---|
| PubChem CID | 176730094 |
| Molecular Formula | C13H6F3NO3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-nitro-4-(3,4,5-trifluorophenyl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc(F)c(F)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H6F3NO3/c14-10-3-9(4-11(15)13(10)16)7-1-2-8(6-18)12(5-7)17(19)20/h1-6H |
| InChIKey | PCCJZGLGEHMVSV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|