About 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol
1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol (PubChem CID 176730363) has the molecular formula C25H40O
and a molecular weight of 356.59 g/mol. Its IUPAC name is 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol |
| PubChem CID | 176730363 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol |
| SMILES | CC(C)=CCC(C)CCCC(Cc1ccccc1)CC1(O)CCCCC1 |
| InChI | InChI=1S/C25H40O/c1-21(2)15-16-22(3)11-10-14-24(19-23-12-6-4-7-13-23)20-25(26)17-8-5-9-18-25/h4,6-7,12-13,15,22,24,26H,5,8-11,14,16-20H2,1-3H3 |
| InChIKey | OUSTWDJVSFOARD-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol?
The IUPAC name of 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol (CID 176730363) is 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol?
The canonical SMILES for 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol is CC(C)=CCC(C)CCCC(Cc1ccccc1)CC1(O)CCCCC1.
What is the InChIKey of 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol?
The InChIKey is OUSTWDJVSFOARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O/c1-21(2)15-16-22(3)11-10-14-24(19-23-12-6-4-7-13-23)20-25(26)17-8-5-9-18-25/h4,6-7,12-13,15,22,24,26H,5,8-11,14,16-20H2,1-3H3.
What are the key properties of 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol?
1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol has a molecular weight of 356.59 g/mol, XLogP of 7.09, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzyl-6,9-dimethyldec-8-enyl)cyclohexan-1-ol is sourced from PubChem (CID 176730363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).