C33H27N3O2 — CID 176730887
2-[[2-[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-pyridinyl]imino]-1,2-diphenylethanol (PubChem CID 176730887) has the molecular formula C33H27N3O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[[2-[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-pyridinyl]imino]-1,2-diphenylethanol.
| Compound Name | 2-[[2-[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-pyridinyl]imino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 176730887 |
| Molecular Formula | C33H27N3O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 2-[[2-[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-pyridinyl]imino]-1,2-diphenylethanol |
| SMILES | OC(/C(=N\c1cccnc1/N=C(\c1ccccc1)C(O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H27N3O2/c37-31(26-18-9-3-10-19-26)29(24-14-5-1-6-15-24)35-28-22-13-23-34-33(28)36-30(25-16-7-2-8-17-25)32(38)27-20-11-4-12-21-27/h1-23,31-32,37-38H/b35-29-,36-30+ |
| InChIKey | UBQCSAJWTPRVAA-CRHVBUSDSA-N |
| XLogP | 6.79 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|