About 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol
4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol (PubChem CID 176732433) has the molecular formula C28H32NO2+
and a molecular weight of 414.57 g/mol. Its IUPAC name is 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol.
Molecular Properties
| Compound Name | 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
| PubChem CID | 176732433 |
| Molecular Formula | C28H32NO2+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
| SMILES | C[N+]1(C)CC(c2ccc(C(=C(CCCO)c3ccccc3)c3ccc(O)cc3)cc2)C1 |
| InChI | InChI=1S/C28H31NO2/c1-29(2)19-25(20-29)21-10-12-23(13-11-21)28(24-14-16-26(31)17-15-24)27(9-6-18-30)22-7-4-3-5-8-22/h3-5,7-8,10-17,25,30H,6,9,18-20H2,1-2H3/p+1 |
| InChIKey | YBGSUPMUKXURDG-UHFFFAOYSA-O |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol?
The IUPAC name of 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol (CID 176732433) is 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol.
What is the SMILES notation for 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol?
The canonical SMILES for 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol is C[N+]1(C)CC(c2ccc(C(=C(CCCO)c3ccccc3)c3ccc(O)cc3)cc2)C1.
What is the InChIKey of 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol?
The InChIKey is YBGSUPMUKXURDG-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H31NO2/c1-29(2)19-25(20-29)21-10-12-23(13-11-21)28(24-14-16-26(31)17-15-24)27(9-6-18-30)22-7-4-3-5-8-22/h3-5,7-8,10-17,25,30H,6,9,18-20H2,1-2H3/p+1.
What are the key properties of 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol?
4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol has a molecular weight of 414.57 g/mol, XLogP of 5.30, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-(1,1-dimethylazetidin-1-ium-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol is sourced from PubChem (CID 176732433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).