About 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol
2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol (PubChem CID 176732949) has the molecular formula C19H17N5O
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol |
| PubChem CID | 176732949 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol |
| SMILES | Cc1ncc(-c2cc3nc(-c4c(C)ccc(O)c4C)cnc3[nH]2)cn1 |
| InChI | InChI=1S/C19H17N5O/c1-10-4-5-17(25)11(2)18(10)16-9-22-19-15(23-16)6-14(24-19)13-7-20-12(3)21-8-13/h4-9,25H,1-3H3,(H,22,24) |
| InChIKey | LZLKENFXWYGOMD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol?
The IUPAC name of 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol (CID 176732949) is 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol.
What is the SMILES notation for 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol?
The canonical SMILES for 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol is Cc1ncc(-c2cc3nc(-c4c(C)ccc(O)c4C)cnc3[nH]2)cn1.
What is the InChIKey of 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol?
The InChIKey is LZLKENFXWYGOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O/c1-10-4-5-17(25)11(2)18(10)16-9-22-19-15(23-16)6-14(24-19)13-7-20-12(3)21-8-13/h4-9,25H,1-3H3,(H,22,24).
What are the key properties of 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol?
2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol has a molecular weight of 331.38 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-[6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenol is sourced from PubChem (CID 176732949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).