C20H22N8O5S — CID 176733045
(5R)-5-[[2-[(5-methyl-6-oxo-1,8a-dihydropyrido[2,3-b]pyrazin-3-yl)oxy]ethylamino]methyl]-3-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 176733045) has the molecular formula C20H22N8O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is (5R)-5-[[2-[(5-methyl-6-oxo-1,8a-dihydropyrido[2,3-b]pyrazin-3-yl)oxy]ethylamino]methyl]-3-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[[2-[(5-methyl-6-oxo-1,8a-dihydropyrido[2,3-b]pyrazin-3-yl)oxy]ethylamino]methyl]-3-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 176733045 |
| Molecular Formula | C20H22N8O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (5R)-5-[[2-[(5-methyl-6-oxo-1,8a-dihydropyrido[2,3-b]pyrazin-3-yl)oxy]ethylamino]methyl]-3-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)C=CC2NC=C(OCCNC[C@@H]3CN(c4cnc5c(n4)NC(=O)CS5)C(=O)O3)N=C21 |
| InChI | InChI=1S/C20H22N8O5S/c1-27-16(30)3-2-12-18(27)26-15(8-22-12)32-5-4-21-6-11-9-28(20(31)33-11)13-7-23-19-17(24-13)25-14(29)10-34-19/h2-3,7-8,11-12,21-22H,4-6,9-10H2,1H3,(H,24,25,29)/t11-,12?/m1/s1 |
| InChIKey | IPDBXDUZQQUXFU-JHJMLUEUSA-N |
| XLogP | -0.35 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|