C27H32F5N6O2P — CID 176733151
(17R,20R)-28-dimethylphosphoryl-13,13-difluoro-11,16-dimethyl-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one (PubChem CID 176733151) has the molecular formula C27H32F5N6O2P and a molecular weight of 598.56 g/mol. Its IUPAC name is (17R,20R)-28-dimethylphosphoryl-13,13-difluoro-11,16-dimethyl-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one.
| Compound Name | (17R,20R)-28-dimethylphosphoryl-13,13-difluoro-11,16-dimethyl-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one |
|---|---|
| PubChem CID | 176733151 |
| Molecular Formula | C27H32F5N6O2P |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | (17R,20R)-28-dimethylphosphoryl-13,13-difluoro-11,16-dimethyl-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one |
| SMILES | CN1CC(F)(F)CCN(C)[C@@H]2CC[C@H](C2)Nc2ncc(C(F)(F)F)c(n2)-c2c[nH]c3c(P(C)(C)=O)c(ccc23)C1=O |
| InChI | InChI=1S/C27H32F5N6O2P/c1-37-10-9-26(28,29)14-38(2)24(39)18-8-7-17-19(12-33-22(17)23(18)41(3,4)40)21-20(27(30,31)32)13-34-25(36-21)35-15-5-6-16(37)11-15/h7-8,12-13,15-16,33H,5-6,9-11,14H2,1-4H3,(H,34,35,36)/t15-,16-/m1/s1 |
| InChIKey | XDSHGIGIKRXBCF-HZPDHXFCSA-N |
| XLogP | 5.27 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|