C21H22F3N3O3 — CID 176734267
(E)-N-[2-[2-methoxyethyl(pyridin-2-ylmethyl)amino]-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 176734267) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is (E)-N-[2-[2-methoxyethyl(pyridin-2-ylmethyl)amino]-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-[2-methoxyethyl(pyridin-2-ylmethyl)amino]-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 176734267 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (E)-N-[2-[2-methoxyethyl(pyridin-2-ylmethyl)amino]-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COCCN(Cc1ccccn1)C(=O)CNC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-30-13-12-27(15-18-4-2-3-11-25-18)20(29)14-26-19(28)10-7-16-5-8-17(9-6-16)21(22,23)24/h2-11H,12-15H2,1H3,(H,26,28)/b10-7+ |
| InChIKey | CTILNHLXMZPSCG-JXMROGBWSA-N |
| XLogP | 2.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|