C25H32F3NO6S — CID 176735055
N-[(3R,4R,5R,6R)-5-butoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 176735055) has the molecular formula C25H32F3NO6S and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-5-butoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(3R,4R,5R,6R)-5-butoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 176735055 |
| Molecular Formula | C25H32F3NO6S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-[(3R,4R,5R,6R)-5-butoxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCCO[C@@H]1[C@H](OCc2ccccc2)[C@H](NS(=O)(=O)C(F)(F)F)CO[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C25H32F3NO6S/c1-2-3-14-33-24-22(18-32-15-19-10-6-4-7-11-19)34-17-21(29-36(30,31)25(26,27)28)23(24)35-16-20-12-8-5-9-13-20/h4-13,21-24,29H,2-3,14-18H2,1H3/t21-,22-,23-,24+/m1/s1 |
| InChIKey | LHIWRTMILCXLKL-YCAMKHIRSA-N |
| XLogP | 4.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|