About 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate
2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate (PubChem CID 176737054) has the molecular formula C17H31BrO4
and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate.
Molecular Properties
| Compound Name | 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate |
| PubChem CID | 176737054 |
| Molecular Formula | C17H31BrO4 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate |
| SMILES | CCCCCCC(CC(C)=O)OC(=O)CC(CCCBr)OC |
| InChI | InChI=1S/C17H31BrO4/c1-4-5-6-7-9-16(12-14(2)19)22-17(20)13-15(21-3)10-8-11-18/h15-16H,4-13H2,1-3H3 |
| InChIKey | MQQPUAPGJNVQMQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate?
The IUPAC name of 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate (CID 176737054) is 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate.
What is the SMILES notation for 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate?
The canonical SMILES for 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate is CCCCCCC(CC(C)=O)OC(=O)CC(CCCBr)OC.
What is the InChIKey of 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate?
The InChIKey is MQQPUAPGJNVQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31BrO4/c1-4-5-6-7-9-16(12-14(2)19)22-17(20)13-15(21-3)10-8-11-18/h15-16H,4-13H2,1-3H3.
What are the key properties of 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate?
2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate has a molecular weight of 379.34 g/mol, XLogP of 4.43, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxodecan-4-yl 6-bromo-3-methoxyhexanoate is sourced from PubChem (CID 176737054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).