C31H31BrO9 — CID 176737242
(17R,18R)-18-(bromomethyl)-13,18-dihydroxy-6,17-dimethoxy-3-methyl-19-(phenylmethoxymethyl)-16,20,22-trioxahexacyclo[17.2.1.02,15.05,14.07,12.017,21]docosa-2(15),3,5(14),6,12-pentaen-11-one (PubChem CID 176737242) has the molecular formula C31H31BrO9 and a molecular weight of 627.48 g/mol. Its IUPAC name is (17R,18R)-18-(bromomethyl)-13,18-dihydroxy-6,17-dimethoxy-3-methyl-19-(phenylmethoxymethyl)-16,20,22-trioxahexacyclo[17.2.1.02,15.05,14.07,12.017,21]docosa-2(15),3,5(14),6,12-pentaen-11-one.
| Compound Name | (17R,18R)-18-(bromomethyl)-13,18-dihydroxy-6,17-dimethoxy-3-methyl-19-(phenylmethoxymethyl)-16,20,22-trioxahexacyclo[17.2.1.02,15.05,14.07,12.017,21]docosa-2(15),3,5(14),6,12-pentaen-11-one |
|---|---|
| PubChem CID | 176737242 |
| Molecular Formula | C31H31BrO9 |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | (17R,18R)-18-(bromomethyl)-13,18-dihydroxy-6,17-dimethoxy-3-methyl-19-(phenylmethoxymethyl)-16,20,22-trioxahexacyclo[17.2.1.02,15.05,14.07,12.017,21]docosa-2(15),3,5(14),6,12-pentaen-11-one |
| SMILES | COc1c2c(c(O)c3c4c(c(C)cc13)C1OC3(COCc5ccccc5)OC1[C@@](OC)(O4)[C@@]3(O)CBr)C(=O)CCC2 |
| InChI | InChI=1S/C31H31BrO9/c1-16-12-19-23(24(34)22-18(25(19)36-2)10-7-11-20(22)33)26-21(16)27-28-31(37-3,40-26)29(35,14-32)30(39-27,41-28)15-38-13-17-8-5-4-6-9-17/h4-6,8-9,12,27-28,34-35H,7,10-11,13-15H2,1-3H3/t27?,28?,29-,30?,31-/m1/s1 |
| InChIKey | ITBUNNJSKQYHFC-HOPQWXDLSA-N |
| XLogP | 4.63 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|