C17H19ClN4O5 — CID 176737507
methyl 2-[4-chloro-2-morpholin-4-yl-6-(pyridin-3-ylmethoxy)pyrimidin-5-yl]oxyacetate (PubChem CID 176737507) has the molecular formula C17H19ClN4O5 and a molecular weight of 394.82 g/mol. Its IUPAC name is methyl 2-[4-chloro-2-morpholin-4-yl-6-(pyridin-3-ylmethoxy)pyrimidin-5-yl]oxyacetate.
| Compound Name | methyl 2-[4-chloro-2-morpholin-4-yl-6-(pyridin-3-ylmethoxy)pyrimidin-5-yl]oxyacetate |
|---|---|
| PubChem CID | 176737507 |
| Molecular Formula | C17H19ClN4O5 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | methyl 2-[4-chloro-2-morpholin-4-yl-6-(pyridin-3-ylmethoxy)pyrimidin-5-yl]oxyacetate |
| SMILES | COC(=O)COc1c(Cl)nc(N2CCOCC2)nc1OCc1cccnc1 |
| InChI | InChI=1S/C17H19ClN4O5/c1-24-13(23)11-26-14-15(18)20-17(22-5-7-25-8-6-22)21-16(14)27-10-12-3-2-4-19-9-12/h2-4,9H,5-8,10-11H2,1H3 |
| InChIKey | ASPPTWKRRSHBSM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |