C15H33N — CID 176737662
N-tert-butyl-N,7,7-trimethyloctan-1-amine (PubChem CID 176737662) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is N-tert-butyl-N,7,7-trimethyloctan-1-amine.
| Compound Name | N-tert-butyl-N,7,7-trimethyloctan-1-amine |
|---|---|
| PubChem CID | 176737662 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N-tert-butyl-N,7,7-trimethyloctan-1-amine |
| SMILES | CN(CCCCCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-14(2,3)12-10-8-9-11-13-16(7)15(4,5)6/h8-13H2,1-7H3 |
| InChIKey | PEEXTEJSSBPNLX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|