About N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine
N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine (PubChem CID 176737675) has the molecular formula C11H23F2N
and a molecular weight of 207.31 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine |
| PubChem CID | 176737675 |
| Molecular Formula | C11H23F2N |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)NCCC(F)(F)C(C)(C)C |
| InChI | InChI=1S/C11H23F2N/c1-9(2,3)11(12,13)7-8-14-10(4,5)6/h14H,7-8H2,1-6H3 |
| InChIKey | NKZPQBWAVFWRLX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine?
The IUPAC name of N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine (CID 176737675) is N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine.
What is the SMILES notation for N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine?
The canonical SMILES for N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine is CC(C)(C)NCCC(F)(F)C(C)(C)C.
What is the InChIKey of N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine?
The InChIKey is NKZPQBWAVFWRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23F2N/c1-9(2,3)11(12,13)7-8-14-10(4,5)6/h14H,7-8H2,1-6H3.
What are the key properties of N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine?
N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine has a molecular weight of 207.31 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,3-difluoro-4,4-dimethylpentan-1-amine is sourced from PubChem (CID 176737675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).