C30H31NO9 — CID 176738072
[(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate (PubChem CID 176738072) has the molecular formula C30H31NO9 and a molecular weight of 549.58 g/mol. Its IUPAC name is [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate.
| Compound Name | [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 176738072 |
| Molecular Formula | C30H31NO9 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | [(1S,4S,7R,9R,11S)-9-tert-butyl-9-hydroxy-5-[2-(4-hydroxyphenyl)ethyl]-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] benzoate |
| SMILES | CC(C)(C)[C@]1(O)C[C@@H]2OC(=O)C[C@@]23C(=O)O[C@@H]2N(CCc4ccc(O)cc4)C(=O)C(OC(=O)c4ccccc4)C213 |
| InChI | InChI=1S/C30H31NO9/c1-27(2,3)29(37)15-20-28(16-21(33)38-20)26(36)40-25-30(28,29)22(39-24(35)18-7-5-4-6-8-18)23(34)31(25)14-13-17-9-11-19(32)12-10-17/h4-12,20,22,25,32,37H,13-16H2,1-3H3/t20-,22?,25-,28-,29+,30?/m0/s1 |
| InChIKey | ZYVFFUQXKPULIA-GGNIWWSJSA-N |
| XLogP | 2.35 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|