C17H21NO9 — CID 176738160
[(1S,4S,7R,9R,10S,11R)-9-tert-butyl-9,10-dihydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate (PubChem CID 176738160) has the molecular formula C17H21NO9 and a molecular weight of 383.35 g/mol. Its IUPAC name is [(1S,4S,7R,9R,10S,11R)-9-tert-butyl-9,10-dihydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate.
| Compound Name | [(1S,4S,7R,9R,10S,11R)-9-tert-butyl-9,10-dihydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate |
|---|---|
| PubChem CID | 176738160 |
| Molecular Formula | C17H21NO9 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [(1S,4S,7R,9R,10S,11R)-9-tert-butyl-9,10-dihydroxy-2,6,13-trioxo-3,12-dioxa-5-azatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate |
| SMILES | CC(=O)OC1C(=O)N[C@H]2OC(=O)[C@]34CC(=O)O[C@H]3[C@H](O)[C@@](O)(C(C)(C)C)C124 |
| InChI | InChI=1S/C17H21NO9/c1-6(19)25-10-11(22)18-12-16(10)15(13(23)27-12)5-7(20)26-9(15)8(21)17(16,24)14(2,3)4/h8-10,12,21,24H,5H2,1-4H3,(H,18,22)/t8-,9-,10?,12-,15-,16?,17+/m0/s1 |
| InChIKey | ZUUFZSNPIBGMGT-BTDNEKRYSA-N |
| XLogP | -1.63 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|