C13H29NO4 — CID 176738273
N,N-diethyl-1,3-bis(2-methoxyethoxy)propan-2-amine (PubChem CID 176738273) has the molecular formula C13H29NO4 and a molecular weight of 263.38 g/mol. Its IUPAC name is N,N-diethyl-1,3-bis(2-methoxyethoxy)propan-2-amine.
| Compound Name | N,N-diethyl-1,3-bis(2-methoxyethoxy)propan-2-amine |
|---|---|
| PubChem CID | 176738273 |
| Molecular Formula | C13H29NO4 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N,N-diethyl-1,3-bis(2-methoxyethoxy)propan-2-amine |
| SMILES | CCN(CC)C(COCCOC)COCCOC |
| InChI | InChI=1S/C13H29NO4/c1-5-14(6-2)13(11-17-9-7-15-3)12-18-10-8-16-4/h13H,5-12H2,1-4H3 |
| InChIKey | HCVVVTZZCANJHS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|