C11H11F5N4 — CID 176739067
2-tert-butyl-7-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 176739067) has the molecular formula C11H11F5N4 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-tert-butyl-7-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 2-tert-butyl-7-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 176739067 |
| Molecular Formula | C11H11F5N4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-tert-butyl-7-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | CC(C)(C)c1nc2cc(C(F)(F)C(F)(F)F)ncn2n1 |
| InChI | InChI=1S/C11H11F5N4/c1-9(2,3)8-18-7-4-6(17-5-20(7)19-8)10(12,13)11(14,15)16/h4-5H,1-3H3 |
| InChIKey | UKLDZLXTMJFQGX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|