About 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one
6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one (PubChem CID 176739497) has the molecular formula C19H16BrFN2O3
and a molecular weight of 419.25 g/mol. Its IUPAC name is 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one |
| PubChem CID | 176739497 |
| Molecular Formula | C19H16BrFN2O3 |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one |
| SMILES | COc1ccc(Cn2nc(O[C@H]3C[C@H]3F)c3cc(Br)ccc3c2=O)cc1 |
| InChI | InChI=1S/C19H16BrFN2O3/c1-25-13-5-2-11(3-6-13)10-23-19(24)14-7-4-12(20)8-15(14)18(22-23)26-17-9-16(17)21/h2-8,16-17H,9-10H2,1H3/t16-,17+/m1/s1 |
| InChIKey | FXMUJWODWJQMBN-SJORKVTESA-N |
| XLogP | 3.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one?
The IUPAC name of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one (CID 176739497) is 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one.
What is the SMILES notation for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one?
The canonical SMILES for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one is COc1ccc(Cn2nc(O[C@H]3C[C@H]3F)c3cc(Br)ccc3c2=O)cc1.
What is the InChIKey of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one?
The InChIKey is FXMUJWODWJQMBN-SJORKVTESA-N. The full InChI is InChI=1S/C19H16BrFN2O3/c1-25-13-5-2-11(3-6-13)10-23-19(24)14-7-4-12(20)8-15(14)18(22-23)26-17-9-16(17)21/h2-8,16-17H,9-10H2,1H3/t16-,17+/m1/s1.
What are the key properties of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one?
6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one has a molecular weight of 419.25 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2-[(4-methoxyphenyl)methyl]phthalazin-1-one is sourced from PubChem (CID 176739497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).