About 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one
6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one (PubChem CID 176739512) has the molecular formula C11H8BrFN2O2
and a molecular weight of 299.10 g/mol. Its IUPAC name is 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one |
| PubChem CID | 176739512 |
| Molecular Formula | C11H8BrFN2O2 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(O[C@H]2C[C@H]2F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C11H8BrFN2O2/c12-5-1-2-6-7(3-5)11(15-14-10(6)16)17-9-4-8(9)13/h1-3,8-9H,4H2,(H,14,16)/t8-,9+/m1/s1 |
| InChIKey | NEQBJDNJPVGJIW-BDAKNGLRSA-N |
| XLogP | 2.17 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one?
The IUPAC name of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one (CID 176739512) is 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one.
What is the SMILES notation for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one?
The canonical SMILES for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one is O=c1[nH]nc(O[C@H]2C[C@H]2F)c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one?
The InChIKey is NEQBJDNJPVGJIW-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H8BrFN2O2/c12-5-1-2-6-7(3-5)11(15-14-10(6)16)17-9-4-8(9)13/h1-3,8-9H,4H2,(H,14,16)/t8-,9+/m1/s1.
What are the key properties of 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one?
6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one has a molecular weight of 299.10 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-[(1S,2R)-2-fluorocyclopropyl]oxy-2H-phthalazin-1-one is sourced from PubChem (CID 176739512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).