C10H14F2N2O — CID 176740567
2-(2,2-difluoropropoxy)-5-propan-2-ylpyrazine (PubChem CID 176740567) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-(2,2-difluoropropoxy)-5-propan-2-ylpyrazine.
| Compound Name | 2-(2,2-difluoropropoxy)-5-propan-2-ylpyrazine |
|---|---|
| PubChem CID | 176740567 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-(2,2-difluoropropoxy)-5-propan-2-ylpyrazine |
| SMILES | CC(C)c1cnc(OCC(C)(F)F)cn1 |
| InChI | InChI=1S/C10H14F2N2O/c1-7(2)8-4-14-9(5-13-8)15-6-10(3,11)12/h4-5,7H,6H2,1-3H3 |
| InChIKey | ZQHVCWXWNYYOKW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |