About 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine
6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine (PubChem CID 176741479) has the molecular formula C7H4BrClFN3
and a molecular weight of 264.49 g/mol. Its IUPAC name is 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine |
| PubChem CID | 176741479 |
| Molecular Formula | C7H4BrClFN3 |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 262.93 |
| IUPAC Name | 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine |
| SMILES | Cc1nc2c(Cl)nc(Br)cn2c1F |
| InChI | InChI=1S/C7H4BrClFN3/c1-3-6(10)13-2-4(8)12-5(9)7(13)11-3/h2H,1H3 |
| InChIKey | CCISGEAQAYYURY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The IUPAC name of 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine (CID 176741479) is 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The canonical SMILES for 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine is Cc1nc2c(Cl)nc(Br)cn2c1F.
What is the InChIKey of 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
The InChIKey is CCISGEAQAYYURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClFN3/c1-3-6(10)13-2-4(8)12-5(9)7(13)11-3/h2H,1H3.
What are the key properties of 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine?
6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine has a molecular weight of 264.49 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-chloro-3-fluoro-2-methylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 176741479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).