C10H10N2O — CID 176741794
6,7,8,9-tetrahydro-[1,2]oxazolo[4,5-f]quinoline (PubChem CID 176741794) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-[1,2]oxazolo[4,5-f]quinoline.
| Compound Name | 6,7,8,9-tetrahydro-[1,2]oxazolo[4,5-f]quinoline |
|---|---|
| PubChem CID | 176741794 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 6,7,8,9-tetrahydro-[1,2]oxazolo[4,5-f]quinoline |
| SMILES | c1cc2oncc2c2c1NCCC2 |
| InChI | InChI=1S/C10H10N2O/c1-2-7-8-6-12-13-10(8)4-3-9(7)11-5-1/h3-4,6,11H,1-2,5H2 |
| InChIKey | FCERDHHBARASBM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |