About 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine
5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine (PubChem CID 176742553) has the molecular formula C15H9BrF2N2O
and a molecular weight of 351.15 g/mol. Its IUPAC name is 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine.
Molecular Properties
| Compound Name | 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine |
| PubChem CID | 176742553 |
| Molecular Formula | C15H9BrF2N2O |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine |
| SMILES | COc1cc(Br)ccc1-c1cc(F)cc2c(F)nncc12 |
| InChI | InChI=1S/C15H9BrF2N2O/c1-21-14-4-8(16)2-3-10(14)11-5-9(17)6-12-13(11)7-19-20-15(12)18/h2-7H,1H3 |
| InChIKey | GYURBSMSOZLGNO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine?
The IUPAC name of 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine (CID 176742553) is 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine.
What is the SMILES notation for 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine?
The canonical SMILES for 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine is COc1cc(Br)ccc1-c1cc(F)cc2c(F)nncc12.
What is the InChIKey of 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine?
The InChIKey is GYURBSMSOZLGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrF2N2O/c1-21-14-4-8(16)2-3-10(14)11-5-9(17)6-12-13(11)7-19-20-15(12)18/h2-7H,1H3.
What are the key properties of 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine?
5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine has a molecular weight of 351.15 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromo-2-methoxyphenyl)-1,7-difluorophthalazine is sourced from PubChem (CID 176742553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).