C44H26O2 — CID 176745092
2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-3-phenyl-[1]benzofuro[2,3-g][1]benzofuran (PubChem CID 176745092) has the molecular formula C44H26O2 and a molecular weight of 601.78 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-3-phenyl-[1]benzofuro[2,3-g][1]benzofuran.
| Compound Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-3-phenyl-[1]benzofuro[2,3-g][1]benzofuran |
|---|---|
| PubChem CID | 176745092 |
| Molecular Formula | C44H26O2 |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]-3-phenyl-[1]benzofuro[2,3-g][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4oc5c(ccc6oc7ccccc7c65)c4-c4ccccc4)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C44H26O2/c1-2-14-28(15-3-1)39-36-25-26-38-42(35-22-10-11-24-37(35)45-38)43(36)46-44(39)41-33-20-8-6-18-31(33)40(32-19-7-9-21-34(32)41)30-23-12-16-27-13-4-5-17-29(27)30/h1-26H/i4D,5D,6D,7D,8D,9D,12D,13D,16D,17D,18D,19D,20D,21D,23D |
| InChIKey | ZTBQTLCYBAZHEQ-WNGMRKEPSA-N |
| XLogP | 12.79 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|