C34H20O2 — CID 176745735
1,2,4,5,8,9,10-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-[1]benzofuro[3,2-e][1]benzofuran (PubChem CID 176745735) has the molecular formula C34H20O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is 1,2,4,5,8,9,10-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-[1]benzofuro[3,2-e][1]benzofuran.
| Compound Name | 1,2,4,5,8,9,10-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-[1]benzofuro[3,2-e][1]benzofuran |
|---|---|
| PubChem CID | 176745735 |
| Molecular Formula | C34H20O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 1,2,4,5,8,9,10-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-[1]benzofuro[3,2-e][1]benzofuran |
| SMILES | [2H]c1oc2c([2H])c([2H])c3oc4c(-c5c6c([2H])c([2H])c([2H])c([2H])c6c(-c6c([2H])c([2H])c([2H])c([2H])c6[2H])c6c([2H])c([2H])c([2H])c([2H])c56)c([2H])c([2H])c([2H])c4c3c2c1[2H] |
| InChI | InChI=1S/C34H20O2/c1-2-9-21(10-3-1)31-22-11-4-6-13-24(22)32(25-14-7-5-12-23(25)31)27-15-8-16-28-33-26-19-20-35-29(26)17-18-30(33)36-34(27)28/h1-20H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | FNYZKQOIWIQGPZ-LODXIBBESA-N |
| XLogP | 9.97 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|