C20H12ClF2N3O3 — CID 176746998
3-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one (PubChem CID 176746998) has the molecular formula C20H12ClF2N3O3 and a molecular weight of 415.78 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one.
| Compound Name | 3-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 176746998 |
| Molecular Formula | C20H12ClF2N3O3 |
| Molecular Weight | 415.78 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-5-fluoro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
| SMILES | Cc1c(Cc2ccnc(Cl)c2F)c(=O)oc2cc(Oc3ncccn3)cc(F)c12 |
| InChI | InChI=1S/C20H12ClF2N3O3/c1-10-13(7-11-3-6-24-18(21)17(11)23)19(27)29-15-9-12(8-14(22)16(10)15)28-20-25-4-2-5-26-20/h2-6,8-9H,7H2,1H3 |
| InChIKey | IPGRKMJNDZGZCZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|