C18H12F18N2 — CID 176747378
2-cyclohexyl-4,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine (PubChem CID 176747378) has the molecular formula C18H12F18N2 and a molecular weight of 598.27 g/mol. Its IUPAC name is 2-cyclohexyl-4,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine.
| Compound Name | 2-cyclohexyl-4,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine |
|---|---|
| PubChem CID | 176747378 |
| Molecular Formula | C18H12F18N2 |
| Molecular Weight | 598.27 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-cyclohexyl-4,6-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C18H12F18N2/c19-11(20,13(23,24)15(27,28)17(31,32)33)8-6-9(38-10(37-8)7-4-2-1-3-5-7)12(21,22)14(25,26)16(29,30)18(34,35)36/h6-7H,1-5H2 |
| InChIKey | UIPSSMGXHAVXCL-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.27 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|