C37H21F36N5O4 — CID 176747392
2-[4-[4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pyrimidin-2-yl]phenyl]-4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,3,5-triazine (PubChem CID 176747392) has the molecular formula C37H21F36N5O4 and a molecular weight of 1283.53 g/mol. Its IUPAC name is 2-[4-[4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pyrimidin-2-yl]phenyl]-4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,3,5-triazine.
| Compound Name | 2-[4-[4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pyrimidin-2-yl]phenyl]-4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 176747392 |
| Molecular Formula | C37H21F36N5O4 |
| Molecular Weight | 1283.53 g/mol |
| Exact Mass | 1283.10 |
| IUPAC Name | 2-[4-[4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pyrimidin-2-yl]phenyl]-4,6-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1cc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(-c2ccc(-c3nc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n3)cc2)n1 |
| InChI | InChI=1S/C37H21F36N5O4/c38-22(39,26(46,47)30(54,55)34(62,63)64)5-9-79-16-13-17(80-10-6-23(40,41)27(48,49)31(56,57)35(65,66)67)75-18(74-16)14-1-3-15(4-2-14)19-76-20(81-11-7-24(42,43)28(50,51)32(58,59)36(68,69)70)78-21(77-19)82-12-8-25(44,45)29(52,53)33(60,61)37(71,72)73/h1-4,13H,5-12H2 |
| InChIKey | TVXHJMDBCBAQGV-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 101.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1283.53 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|